C26H36O10 — CID 19888232
tetrakis(2-methylpropyl) 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate (PubChem CID 19888232) has the molecular formula C26H36O10 and a molecular weight of 508.56 g/mol. Its IUPAC name is tetrakis(2-methylpropyl) 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(2-methylpropyl) 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 19888232 |
| Molecular Formula | C26H36O10 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | tetrakis(2-methylpropyl) 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate |
| SMILES | CC(C)COC(=O)C1=C(C(=O)OCC(C)C)C(=O)C(C(=O)OCC(C)C)=C(C(=O)OCC(C)C)C1=O |
| InChI | InChI=1S/C26H36O10/c1-13(2)9-33-23(29)17-18(24(30)34-10-14(3)4)22(28)20(26(32)36-12-16(7)8)19(21(17)27)25(31)35-11-15(5)6/h13-16H,9-12H2,1-8H3 |
| InChIKey | XNNFNLHQCHWYHX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|