C28H28O10S2 — CID 19888259
dipropan-2-yl 2,5-bis-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 19888259) has the molecular formula C28H28O10S2 and a molecular weight of 588.66 g/mol. Its IUPAC name is dipropan-2-yl 2,5-bis-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | dipropan-2-yl 2,5-bis-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 19888259 |
| Molecular Formula | C28H28O10S2 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | dipropan-2-yl 2,5-bis-(4-methylphenyl)sulfonyl-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(C(=O)OC(C)C)C(=O)C(S(=O)(=O)c3ccc(C)cc3)=C(C(=O)OC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H28O10S2/c1-15(2)37-27(31)21-23(29)26(40(35,36)20-13-9-18(6)10-14-20)22(28(32)38-16(3)4)24(30)25(21)39(33,34)19-11-7-17(5)8-12-19/h7-16H,1-6H3 |
| InChIKey | UXUFXUBRZPNGTJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|