C18H20O10 — CID 19888268
tetraethyl 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate (PubChem CID 19888268) has the molecular formula C18H20O10 and a molecular weight of 396.35 g/mol. Its IUPAC name is tetraethyl 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate.
| Compound Name | tetraethyl 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 19888268 |
| Molecular Formula | C18H20O10 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | tetraethyl 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(=O)C(C(=O)OCC)=C(C(=O)OCC)C1=O |
| InChI | InChI=1S/C18H20O10/c1-5-25-15(21)9-10(16(22)26-6-2)14(20)12(18(24)28-8-4)11(13(9)19)17(23)27-7-3/h5-8H2,1-4H3 |
| InChIKey | GYBIPSAIBKENIC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|