C22H36O10S4 — CID 19888270
3,4,5,6-tetrakis(2-methylpropylsulfonyl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 19888270) has the molecular formula C22H36O10S4 and a molecular weight of 588.79 g/mol. Its IUPAC name is 3,4,5,6-tetrakis(2-methylpropylsulfonyl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3,4,5,6-tetrakis(2-methylpropylsulfonyl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 19888270 |
| Molecular Formula | C22H36O10S4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 3,4,5,6-tetrakis(2-methylpropylsulfonyl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(C)CS(=O)(=O)C1=C(S(=O)(=O)CC(C)C)C(S(=O)(=O)CC(C)C)=C(S(=O)(=O)CC(C)C)C(=O)C1=O |
| InChI | InChI=1S/C22H36O10S4/c1-13(2)9-33(25,26)19-17(23)18(24)20(34(27,28)10-14(3)4)22(36(31,32)12-16(7)8)21(19)35(29,30)11-15(5)6/h13-16H,9-12H2,1-8H3 |
| InChIKey | MXCMKDWYSRHQEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 170.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|