C23H27N3O2S — CID 19888455
3-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-2lambda6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide (PubChem CID 19888455) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 3-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-2lambda6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide.
| Compound Name | 3-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-2lambda6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide |
|---|---|
| PubChem CID | 19888455 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-2lambda6-thia-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene 2,2-dioxide |
| SMILES | O=S1(=O)N(CCCN2CC=C(c3ccccc3)CC2)c2cccc3c2N1CCC3 |
| InChI | InChI=1S/C23H27N3O2S/c27-29(28)25(22-11-4-9-21-10-5-15-26(29)23(21)22)16-6-14-24-17-12-20(13-18-24)19-7-2-1-3-8-19/h1-4,7-9,11-12H,5-6,10,13-18H2 |
| InChIKey | XUYGUILRYSTNIP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |