C12H9ClN4S — CID 19889046
7-(3-chlorophenyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione (PubChem CID 19889046) has the molecular formula C12H9ClN4S and a molecular weight of 276.75 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione.
| Compound Name | 7-(3-chlorophenyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione |
|---|---|
| PubChem CID | 19889046 |
| Molecular Formula | C12H9ClN4S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 7-(3-chlorophenyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione |
| SMILES | Cc1cc(-c2cccc(Cl)c2)n2[nH]c(=S)nc2n1 |
| InChI | InChI=1S/C12H9ClN4S/c1-7-5-10(8-3-2-4-9(13)6-8)17-11(14-7)15-12(18)16-17/h2-6H,1H3,(H,16,18) |
| InChIKey | MMHLYFQOQZLMGT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|