About 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine
2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine (PubChem CID 19889990) has the molecular formula C16H37NO2
and a molecular weight of 275.48 g/mol. Its IUPAC name is 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine.
Molecular Properties
| Compound Name | 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine |
| PubChem CID | 19889990 |
| Molecular Formula | C16H37NO2 |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.28 |
| IUPAC Name | 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine |
| SMILES | CCC(C)(O)CO.CCCCCN(C)CCCCC |
| InChI | InChI=1S/C11H25N.C5H12O2/c1-4-6-8-10-12(3)11-9-7-5-2;1-3-5(2,7)4-6/h4-11H2,1-3H3;6-7H,3-4H2,1-2H3 |
| InChIKey | XFWCHQXLAHUCHU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine?
The IUPAC name of 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine (CID 19889990) is 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine.
What is the SMILES notation for 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine?
The canonical SMILES for 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine is CCC(C)(O)CO.CCCCCN(C)CCCCC.
What is the InChIKey of 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine?
The InChIKey is XFWCHQXLAHUCHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N.C5H12O2/c1-4-6-8-10-12(3)11-9-7-5-2;1-3-5(2,7)4-6/h4-11H2,1-3H3;6-7H,3-4H2,1-2H3.
What are the key properties of 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine?
2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine has a molecular weight of 275.48 g/mol, XLogP of 3.44, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane-1,2-diol;N-methyl-N-pentylpentan-1-amine is sourced from PubChem (CID 19889990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).