About chromene-2-thione
chromene-2-thione (PubChem CID 19890) has the molecular formula C9H6OS
and a molecular weight of 162.21 g/mol. Its IUPAC name is chromene-2-thione.
Molecular Properties
| Compound Name | chromene-2-thione |
| PubChem CID | 19890 |
| Molecular Formula | C9H6OS |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | chromene-2-thione |
| SMILES | S=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6OS/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6H |
| InChIKey | FRZDLTCXOSFHJC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze chromene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromene-2-thione?
The IUPAC name of chromene-2-thione (CID 19890) is chromene-2-thione.
What is the SMILES notation for chromene-2-thione?
The canonical SMILES for chromene-2-thione is S=c1ccc2ccccc2o1.
What is the InChIKey of chromene-2-thione?
The InChIKey is FRZDLTCXOSFHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6OS/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6H.
What are the key properties of chromene-2-thione?
chromene-2-thione has a molecular weight of 162.21 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromene-2-thione is sourced from PubChem (CID 19890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).