About N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol
N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol (PubChem CID 19890048) has the molecular formula C18H41NO2
and a molecular weight of 303.53 g/mol. Its IUPAC name is N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol.
Molecular Properties
| Compound Name | N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol |
| PubChem CID | 19890048 |
| Molecular Formula | C18H41NO2 |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.31 |
| IUPAC Name | N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol |
| SMILES | CCC(C)(O)CO.CCCCCCN(C)CCCCCC |
| InChI | InChI=1S/C13H29N.C5H12O2/c1-4-6-8-10-12-14(3)13-11-9-7-5-2;1-3-5(2,7)4-6/h4-13H2,1-3H3;6-7H,3-4H2,1-2H3 |
| InChIKey | BSSDHZRHSHZNNV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol?
The IUPAC name of N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol (CID 19890048) is N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol.
What is the SMILES notation for N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol?
The canonical SMILES for N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol is CCC(C)(O)CO.CCCCCCN(C)CCCCCC.
What is the InChIKey of N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol?
The InChIKey is BSSDHZRHSHZNNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N.C5H12O2/c1-4-6-8-10-12-14(3)13-11-9-7-5-2;1-3-5(2,7)4-6/h4-13H2,1-3H3;6-7H,3-4H2,1-2H3.
What are the key properties of N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol?
N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol has a molecular weight of 303.53 g/mol, XLogP of 4.22, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-N-methylhexan-1-amine;2-methylbutane-1,2-diol is sourced from PubChem (CID 19890048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).