C14H15Cl3N4O2 — CID 19890361
N-(2-butylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide (PubChem CID 19890361) has the molecular formula C14H15Cl3N4O2 and a molecular weight of 377.66 g/mol. Its IUPAC name is N-(2-butylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide.
| Compound Name | N-(2-butylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 19890361 |
| Molecular Formula | C14H15Cl3N4O2 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-(2-butylpyrazol-3-yl)-2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetamide |
| SMILES | CCCCn1nccc1NC(=O)COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl3N4O2/c1-2-3-6-21-11(4-5-18-21)19-12(22)8-23-14-10(16)7-9(15)13(17)20-14/h4-5,7H,2-3,6,8H2,1H3,(H,19,22) |
| InChIKey | QYXNJHDWHXIXDB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|