About 1,2-dibutoxybutane
1,2-dibutoxybutane (PubChem CID 19890483) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,2-dibutoxybutane.
Molecular Properties
| Compound Name | 1,2-dibutoxybutane |
| PubChem CID | 19890483 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 1,2-dibutoxybutane |
| SMILES | CCCCOCC(CC)OCCCC |
| InChI | InChI=1S/C12H26O2/c1-4-7-9-13-11-12(6-3)14-10-8-5-2/h12H,4-11H2,1-3H3 |
| InChIKey | ZYMFJFJMNLQRCC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibutoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibutoxybutane?
The IUPAC name of 1,2-dibutoxybutane (CID 19890483) is 1,2-dibutoxybutane.
What is the SMILES notation for 1,2-dibutoxybutane?
The canonical SMILES for 1,2-dibutoxybutane is CCCCOCC(CC)OCCCC.
What is the InChIKey of 1,2-dibutoxybutane?
The InChIKey is ZYMFJFJMNLQRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-4-7-9-13-11-12(6-3)14-10-8-5-2/h12H,4-11H2,1-3H3.
What are the key properties of 1,2-dibutoxybutane?
1,2-dibutoxybutane has a molecular weight of 202.34 g/mol, XLogP of 3.40, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibutoxybutane is sourced from PubChem (CID 19890483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).