C13H17F3NO4P — CID 19890552
butane;oxido-oxo-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methoxy]phosphanium (PubChem CID 19890552) has the molecular formula C13H17F3NO4P and a molecular weight of 339.25 g/mol. Its IUPAC name is butane;oxido-oxo-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methoxy]phosphanium.
| Compound Name | butane;oxido-oxo-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methoxy]phosphanium |
|---|---|
| PubChem CID | 19890552 |
| Molecular Formula | C13H17F3NO4P |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | butane;oxido-oxo-[[4-[(2,2,2-trifluoroacetyl)amino]phenyl]methoxy]phosphanium |
| SMILES | CCCC.O=C(Nc1ccc(CO[P+](=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C9H7F3NO4P.C4H10/c10-9(11,12)8(14)13-7-3-1-6(2-4-7)5-17-18(15)16;1-3-4-2/h1-4H,5H2,(H,13,14);3-4H2,1-2H3 |
| InChIKey | TXDAFTJUEOEURE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|