About 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one
6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one (PubChem CID 19890809) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one.
Molecular Properties
| Compound Name | 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one |
| PubChem CID | 19890809 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one |
| SMILES | CCOc1ccc2[nH]c(CC)cc(=O)c2n1 |
| InChI | InChI=1S/C12H14N2O2/c1-3-8-7-10(15)12-9(13-8)5-6-11(14-12)16-4-2/h5-7H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | BHVKMBGIHKFECK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one?
The IUPAC name of 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one (CID 19890809) is 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one.
What is the SMILES notation for 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one?
The canonical SMILES for 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one is CCOc1ccc2[nH]c(CC)cc(=O)c2n1.
What is the InChIKey of 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one?
The InChIKey is BHVKMBGIHKFECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-3-8-7-10(15)12-9(13-8)5-6-11(14-12)16-4-2/h5-7H,3-4H2,1-2H3,(H,13,15).
What are the key properties of 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one?
6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one has a molecular weight of 218.26 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2-ethyl-1H-1,5-naphthyridin-4-one is sourced from PubChem (CID 19890809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).