C18H22N2O4 — CID 19891053
2-[[3-(3-aminophenoxy)propylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol (PubChem CID 19891053) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[[3-(3-aminophenoxy)propylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol.
| Compound Name | 2-[[3-(3-aminophenoxy)propylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol |
|---|---|
| PubChem CID | 19891053 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-[[3-(3-aminophenoxy)propylamino]methyl]-2,3-dihydro-1,4-benzodioxin-5-ol |
| SMILES | Nc1cccc(OCCCNCC2COc3c(O)cccc3O2)c1 |
| InChI | InChI=1S/C18H22N2O4/c19-13-4-1-5-14(10-13)22-9-3-8-20-11-15-12-23-18-16(21)6-2-7-17(18)24-15/h1-2,4-7,10,15,20-21H,3,8-9,11-12,19H2 |
| InChIKey | RWVOBRFDSBMWGH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|