C25H34O5 — CID 19891742
methyl (2E,4E,6E,8E)-9-[4-(2-ethoxy-2-oxoethyl)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 19891742) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E)-9-[4-(2-ethoxy-2-oxoethyl)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6E,8E)-9-[4-(2-ethoxy-2-oxoethyl)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 19891742 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | methyl (2E,4E,6E,8E)-9-[4-(2-ethoxy-2-oxoethyl)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)CC1CC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC)=C(C)C1=O |
| InChI | InChI=1S/C25H34O5/c1-8-30-23(27)15-20-16-25(5,6)21(19(4)24(20)28)13-12-17(2)10-9-11-18(3)14-22(26)29-7/h9-14,20H,8,15-16H2,1-7H3/b11-9+,13-12+,17-10+,18-14+ |
| InChIKey | JSMUUFKFTKRCAQ-KNSIPEQSSA-N |
| XLogP | 5.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|