About 1,1-difluoroethene;ethanol
1,1-difluoroethene;ethanol (PubChem CID 19891756) has the molecular formula C4H8F2O
and a molecular weight of 110.10 g/mol. Its IUPAC name is 1,1-difluoroethene;ethanol.
Molecular Properties
| Compound Name | 1,1-difluoroethene;ethanol |
| PubChem CID | 19891756 |
| Molecular Formula | C4H8F2O |
| Molecular Weight | 110.10 g/mol |
| Exact Mass | 110.05 |
| IUPAC Name | 1,1-difluoroethene;ethanol |
| SMILES | C=C(F)F.CCO |
| InChI | InChI=1S/C2H2F2.C2H6O/c1-2(3)4;1-2-3/h1H2;3H,2H2,1H3 |
| InChIKey | LQWUBPBRZPUDIS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.10 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-difluoroethene;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethene;ethanol?
The IUPAC name of 1,1-difluoroethene;ethanol (CID 19891756) is 1,1-difluoroethene;ethanol.
What is the SMILES notation for 1,1-difluoroethene;ethanol?
The canonical SMILES for 1,1-difluoroethene;ethanol is C=C(F)F.CCO.
What is the InChIKey of 1,1-difluoroethene;ethanol?
The InChIKey is LQWUBPBRZPUDIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2.C2H6O/c1-2(3)4;1-2-3/h1H2;3H,2H2,1H3.
What are the key properties of 1,1-difluoroethene;ethanol?
1,1-difluoroethene;ethanol has a molecular weight of 110.10 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethene;ethanol is sourced from PubChem (CID 19891756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).