C37H22F6N2O8 — CID 19891759
4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 19891759) has the molecular formula C37H22F6N2O8 and a molecular weight of 736.58 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 19891759 |
| Molecular Formula | C37H22F6N2O8 |
| Molecular Weight | 736.58 g/mol |
| Exact Mass | 736.13 |
| IUPAC Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1.O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C27H20F6N2O2.C10H2O6/c28-26(29,30)25(27(31,32)33,17-1-9-21(10-2-17)36-23-13-5-19(34)6-14-23)18-3-11-22(12-4-18)37-24-15-7-20(35)8-16-24;11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7/h1-16H,34-35H2;1-2H |
| InChIKey | CBLXQSHVWLYGOS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 165.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|