About 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid
2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid (PubChem CID 19891889) has the molecular formula C13H18N3O5P
and a molecular weight of 327.28 g/mol. Its IUPAC name is 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid |
| PubChem CID | 19891889 |
| Molecular Formula | C13H18N3O5P |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid |
| SMILES | Cc1cc2nc(CC(N)C(=O)O)n(CP(=O)(O)O)c2cc1C |
| InChI | InChI=1S/C13H18N3O5P/c1-7-3-10-11(4-8(7)2)16(6-22(19,20)21)12(15-10)5-9(14)13(17)18/h3-4,9H,5-6,14H2,1-2H3,(H,17,18)(H2,19,20,21) |
| InChIKey | YVRNGHASPMHOMK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid?
The IUPAC name of 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid (CID 19891889) is 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid.
What is the SMILES notation for 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid?
The canonical SMILES for 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid is Cc1cc2nc(CC(N)C(=O)O)n(CP(=O)(O)O)c2cc1C.
What is the InChIKey of 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid?
The InChIKey is YVRNGHASPMHOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N3O5P/c1-7-3-10-11(4-8(7)2)16(6-22(19,20)21)12(15-10)5-9(14)13(17)18/h3-4,9H,5-6,14H2,1-2H3,(H,17,18)(H2,19,20,21).
What are the key properties of 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid?
2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid has a molecular weight of 327.28 g/mol, XLogP of 0.74, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[5,6-dimethyl-1-(phosphonomethyl)benzimidazol-2-yl]propanoic acid is sourced from PubChem (CID 19891889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).