C76H142N4O12 — CID 19892351
tetrakis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 19892351) has the molecular formula C76H142N4O12 and a molecular weight of 1303.99 g/mol. Its IUPAC name is tetrakis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 19892351 |
| Molecular Formula | C76H142N4O12 |
| Molecular Weight | 1303.99 g/mol |
| Exact Mass | 1303.06 |
| IUPAC Name | tetrakis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CCCCCCCCON1C(C)(C)CC(OC(=O)CC(C(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)C(CC(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)C(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C76H142N4O12/c1-21-25-29-33-37-41-45-85-77-69(5,6)51-59(52-70(77,7)8)89-65(81)49-63(67(83)91-61-55-73(13,14)79(74(15,16)56-61)87-47-43-39-35-31-27-23-3)64(68(84)92-62-57-75(17,18)80(76(19,20)58-62)88-48-44-40-36-32-28-24-4)50-66(82)90-60-53-71(9,10)78(72(11,12)54-60)86-46-42-38-34-30-26-22-2/h59-64H,21-58H2,1-20H3 |
| InChIKey | KENLSNVCPGVROT-UHFFFAOYSA-N |
| XLogP | 18.43 |
| TPSA | 155.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1303.99 |
| LogP ≤ 5 | 18.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|