C40H46FNO5PSi+ — CID 19892493
[2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]prop-2-ynoxy]-oxophosphanium (PubChem CID 19892493) has the molecular formula C40H46FNO5PSi+ and a molecular weight of 698.87 g/mol. Its IUPAC name is [2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]prop-2-ynoxy]-oxophosphanium.
| Compound Name | [2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]prop-2-ynoxy]-oxophosphanium |
|---|---|
| PubChem CID | 19892493 |
| Molecular Formula | C40H46FNO5PSi+ |
| Molecular Weight | 698.87 g/mol |
| Exact Mass | 698.29 |
| IUPAC Name | [2-[tert-butyl(diphenyl)silyl]oxy-3-carboxypropyl]-[3-[1-(4-fluorophenyl)-3-propan-2-yl-5,6,7,8-tetrahydroindolizin-2-yl]prop-2-ynoxy]-oxophosphanium |
| SMILES | CC(C)c1c(C#CCO[P+](=O)CC(CC(=O)O)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(-c2ccc(F)cc2)c2n1CCCC2 |
| InChI | InChI=1S/C40H45FNO5PSi/c1-29(2)39-35(38(30-21-23-31(41)24-22-30)36-20-12-13-25-42(36)39)19-14-26-46-48(45)28-32(27-37(43)44)47-49(40(3,4)5,33-15-8-6-9-16-33)34-17-10-7-11-18-34/h6-11,15-18,21-24,29,32H,12-13,20,25-28H2,1-5H3/p+1 |
| InChIKey | DEVIHHPGOCMHHB-UHFFFAOYSA-O |
| XLogP | 8.28 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.87 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|