About 9-benzylidene-2,7-diiodofluorene
9-benzylidene-2,7-diiodofluorene (PubChem CID 19892568) has the molecular formula C20H12I2
and a molecular weight of 506.12 g/mol. Its IUPAC name is 9-benzylidene-2,7-diiodofluorene.
Molecular Properties
| Compound Name | 9-benzylidene-2,7-diiodofluorene |
| PubChem CID | 19892568 |
| Molecular Formula | C20H12I2 |
| Molecular Weight | 506.12 g/mol |
| Exact Mass | 505.90 |
| IUPAC Name | 9-benzylidene-2,7-diiodofluorene |
| SMILES | Ic1ccc2c(c1)C(=Cc1ccccc1)c1cc(I)ccc1-2 |
| InChI | InChI=1S/C20H12I2/c21-14-6-8-16-17-9-7-15(22)12-20(17)18(19(16)11-14)10-13-4-2-1-3-5-13/h1-12H |
| InChIKey | SYCVVCIAGYJVFB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.12 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 9-benzylidene-2,7-diiodofluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzylidene-2,7-diiodofluorene?
The IUPAC name of 9-benzylidene-2,7-diiodofluorene (CID 19892568) is 9-benzylidene-2,7-diiodofluorene.
What is the SMILES notation for 9-benzylidene-2,7-diiodofluorene?
The canonical SMILES for 9-benzylidene-2,7-diiodofluorene is Ic1ccc2c(c1)C(=Cc1ccccc1)c1cc(I)ccc1-2.
What is the InChIKey of 9-benzylidene-2,7-diiodofluorene?
The InChIKey is SYCVVCIAGYJVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12I2/c21-14-6-8-16-17-9-7-15(22)12-20(17)18(19(16)11-14)10-13-4-2-1-3-5-13/h1-12H.
What are the key properties of 9-benzylidene-2,7-diiodofluorene?
9-benzylidene-2,7-diiodofluorene has a molecular weight of 506.12 g/mol, XLogP of 6.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzylidene-2,7-diiodofluorene is sourced from PubChem (CID 19892568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).