About 2-ethenylquinolin-3-ol;formamide
2-ethenylquinolin-3-ol;formamide (PubChem CID 19892865) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-ethenylquinolin-3-ol;formamide.
Molecular Properties
| Compound Name | 2-ethenylquinolin-3-ol;formamide |
| PubChem CID | 19892865 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-ethenylquinolin-3-ol;formamide |
| SMILES | C=Cc1nc2ccccc2cc1O.NC=O |
| InChI | InChI=1S/C11H9NO.CH3NO/c1-2-9-11(13)7-8-5-3-4-6-10(8)12-9;2-1-3/h2-7,13H,1H2;1H,(H2,2,3) |
| InChIKey | FQYJIYJAIKRLLM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylquinolin-3-ol;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylquinolin-3-ol;formamide?
The IUPAC name of 2-ethenylquinolin-3-ol;formamide (CID 19892865) is 2-ethenylquinolin-3-ol;formamide.
What is the SMILES notation for 2-ethenylquinolin-3-ol;formamide?
The canonical SMILES for 2-ethenylquinolin-3-ol;formamide is C=Cc1nc2ccccc2cc1O.NC=O.
What is the InChIKey of 2-ethenylquinolin-3-ol;formamide?
The InChIKey is FQYJIYJAIKRLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO.CH3NO/c1-2-9-11(13)7-8-5-3-4-6-10(8)12-9;2-1-3/h2-7,13H,1H2;1H,(H2,2,3).
What are the key properties of 2-ethenylquinolin-3-ol;formamide?
2-ethenylquinolin-3-ol;formamide has a molecular weight of 216.24 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylquinolin-3-ol;formamide is sourced from PubChem (CID 19892865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).