C13H17NO3 — CID 19892910
4-ethenyl-1,2,3,4-tetrahydronaphthalene-1,3-diol;formamide (PubChem CID 19892910) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-ethenyl-1,2,3,4-tetrahydronaphthalene-1,3-diol;formamide.
| Compound Name | 4-ethenyl-1,2,3,4-tetrahydronaphthalene-1,3-diol;formamide |
|---|---|
| PubChem CID | 19892910 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-ethenyl-1,2,3,4-tetrahydronaphthalene-1,3-diol;formamide |
| SMILES | C=CC1c2ccccc2C(O)CC1O.NC=O |
| InChI | InChI=1S/C12H14O2.CH3NO/c1-2-8-9-5-3-4-6-10(9)12(14)7-11(8)13;2-1-3/h2-6,8,11-14H,1,7H2;1H,(H2,2,3) |
| InChIKey | JFRLZFLDJWKHMW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|