C18H30O10 — CID 19893220
1,2,3,5-tetrahydroxypentadec-14-ene-1,2,3-tricarboxylic acid (PubChem CID 19893220) has the molecular formula C18H30O10 and a molecular weight of 406.43 g/mol. Its IUPAC name is 1,2,3,5-tetrahydroxypentadec-14-ene-1,2,3-tricarboxylic acid.
| Compound Name | 1,2,3,5-tetrahydroxypentadec-14-ene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 19893220 |
| Molecular Formula | C18H30O10 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1,2,3,5-tetrahydroxypentadec-14-ene-1,2,3-tricarboxylic acid |
| SMILES | C=CCCCCCCCCC(O)CC(O)(C(=O)O)C(O)(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C18H30O10/c1-2-3-4-5-6-7-8-9-10-12(19)11-17(27,15(23)24)18(28,16(25)26)13(20)14(21)22/h2,12-13,19-20,27-28H,1,3-11H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | VTXOBBSYHGIENC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|