C38H69N3O6 — CID 19893451
2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-4-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]butanoic acid (PubChem CID 19893451) has the molecular formula C38H69N3O6 and a molecular weight of 663.99 g/mol. Its IUPAC name is 2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-4-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]butanoic acid.
| Compound Name | 2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-4-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 19893451 |
| Molecular Formula | C38H69N3O6 |
| Molecular Weight | 663.99 g/mol |
| Exact Mass | 663.52 |
| IUPAC Name | 2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-4-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]butanoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCC(C)N(C(N)=O)C1(C(CCNC(=O)C2OC(C)(C)OCC2(C)C)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C38H69N3O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-21-24-30(2)41(35(39)45)38(26-22-20-23-27-38)31(34(43)44)25-28-40-33(42)32-36(3,4)29-46-37(5,6)47-32/h14-15,30-32H,7-13,16-29H2,1-6H3,(H2,39,45)(H,40,42)(H,43,44)/b15-14+ |
| InChIKey | KBNGUUDUNDATEM-CCEZHUSRSA-N |
| XLogP | 8.49 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.99 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|