C34H61N3O6 — CID 19893468
[2-[(1-octylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate (PubChem CID 19893468) has the molecular formula C34H61N3O6 and a molecular weight of 607.88 g/mol. Its IUPAC name is [2-[(1-octylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate.
| Compound Name | [2-[(1-octylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 19893468 |
| Molecular Formula | C34H61N3O6 |
| Molecular Weight | 607.88 g/mol |
| Exact Mass | 607.46 |
| IUPAC Name | [2-[(1-octylcyclohexyl)carbamoylamino]cycloheptyl] 3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoate |
| SMILES | CCCCCCCCC1(NC(=O)NC2CCCCCC2OC(=O)CCNC(=O)C2OC(C)(C)OCC2(C)C)CCCCC1 |
| InChI | InChI=1S/C34H61N3O6/c1-6-7-8-9-10-15-21-34(22-16-12-17-23-34)37-31(40)36-26-18-13-11-14-19-27(26)42-28(38)20-24-35-30(39)29-32(2,3)25-41-33(4,5)43-29/h26-27,29H,6-25H2,1-5H3,(H,35,39)(H2,36,37,40) |
| InChIKey | YAWCRKQPQUBERJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.88 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|