C41H73N3O6 — CID 19893481
2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclohexyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid (PubChem CID 19893481) has the molecular formula C41H73N3O6 and a molecular weight of 704.05 g/mol. Its IUPAC name is 2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclohexyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid.
| Compound Name | 2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclohexyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 19893481 |
| Molecular Formula | C41H73N3O6 |
| Molecular Weight | 704.05 g/mol |
| Exact Mass | 703.55 |
| IUPAC Name | 2-[1-[carbamoyl-[1-[(E)-hexadec-6-enyl]cyclohexyl]amino]cyclohexyl]-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]propanoic acid |
| SMILES | CCCCCCCCC/C=C/CCCCCC1(N(C(N)=O)C2(C(CNC(=O)C3OC(C)(C)OCC3(C)C)C(=O)O)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C41H73N3O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-21-26-40(27-22-19-23-28-40)44(37(42)48)41(29-24-20-25-30-41)33(36(46)47)31-43-35(45)34-38(2,3)32-49-39(4,5)50-34/h14-15,33-34H,6-13,16-32H2,1-5H3,(H2,42,48)(H,43,45)(H,46,47)/b15-14+ |
| InChIKey | UVWBUCSDJYKOTN-CCEZHUSRSA-N |
| XLogP | 9.41 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.05 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|