C39H71N3O6 — CID 19893494
2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-5-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]pentanoic acid (PubChem CID 19893494) has the molecular formula C39H71N3O6 and a molecular weight of 678.01 g/mol. Its IUPAC name is 2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-5-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-5-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 19893494 |
| Molecular Formula | C39H71N3O6 |
| Molecular Weight | 678.01 g/mol |
| Exact Mass | 677.53 |
| IUPAC Name | 2-[1-[carbamoyl-[(E)-octadec-9-en-2-yl]amino]cyclohexyl]-5-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]pentanoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCC(C)N(C(N)=O)C1(C(CCCNC(=O)C2OC(C)(C)OCC2(C)C)C(=O)O)CCCCC1 |
| InChI | InChI=1S/C39H71N3O6/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-21-25-31(2)42(36(40)46)39(27-22-20-23-28-39)32(35(44)45)26-24-29-41-34(43)33-37(3,4)30-47-38(5,6)48-33/h14-15,31-33H,7-13,16-30H2,1-6H3,(H2,40,46)(H,41,43)(H,44,45)/b15-14+ |
| InChIKey | SHVRJIDYTNVCQH-CCEZHUSRSA-N |
| XLogP | 8.88 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.01 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|