C32H47N3O13S — CID 19893682
[3-acetyloxy-4-[[3-(4-aminophenyl)sulfanyl-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate;3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoic acid (PubChem CID 19893682) has the molecular formula C32H47N3O13S and a molecular weight of 713.80 g/mol. Its IUPAC name is [3-acetyloxy-4-[[3-(4-aminophenyl)sulfanyl-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate;3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoic acid.
| Compound Name | [3-acetyloxy-4-[[3-(4-aminophenyl)sulfanyl-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate;3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 19893682 |
| Molecular Formula | C32H47N3O13S |
| Molecular Weight | 713.80 g/mol |
| Exact Mass | 713.28 |
| IUPAC Name | [3-acetyloxy-4-[[3-(4-aminophenyl)sulfanyl-3-oxopropyl]amino]-2,2-dimethyl-4-oxobutyl] acetate;3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoic acid |
| SMILES | CC(=O)OCC(C)(C)C(OC(C)=O)C(=O)NCCC(=O)O.CC(=O)OCC(C)(C)C(OC(C)=O)C(=O)NCCC(=O)Sc1ccc(N)cc1 |
| InChI | InChI=1S/C19H26N2O6S.C13H21NO7/c1-12(22)26-11-19(3,4)17(27-13(2)23)18(25)21-10-9-16(24)28-15-7-5-14(20)6-8-15;1-8(15)20-7-13(3,4)11(21-9(2)16)12(19)14-6-5-10(17)18/h5-8,17H,9-11,20H2,1-4H3,(H,21,25);11H,5-7H2,1-4H3,(H,14,19)(H,17,18) |
| InChIKey | NOIOTFJGOYYZED-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 243.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.80 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|