About azanium;propan-2-ol;hydroxide;hydrate
azanium;propan-2-ol;hydroxide;hydrate (PubChem CID 19893943) has the molecular formula C3H15NO3
and a molecular weight of 113.16 g/mol. Its IUPAC name is azanium;propan-2-ol;hydroxide;hydrate.
Molecular Properties
| Compound Name | azanium;propan-2-ol;hydroxide;hydrate |
| PubChem CID | 19893943 |
| Molecular Formula | C3H15NO3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.11 |
| IUPAC Name | azanium;propan-2-ol;hydroxide;hydrate |
| SMILES | CC(C)O.O.[NH4+].[OH-] |
| InChI | InChI=1S/C3H8O.H3N.2H2O/c1-3(2)4;;;/h3-4H,1-2H3;1H3;2*1H2 |
| InChIKey | XCFYSTUTBNWXLO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium;propan-2-ol;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;propan-2-ol;hydroxide;hydrate?
The IUPAC name of azanium;propan-2-ol;hydroxide;hydrate (CID 19893943) is azanium;propan-2-ol;hydroxide;hydrate.
What is the SMILES notation for azanium;propan-2-ol;hydroxide;hydrate?
The canonical SMILES for azanium;propan-2-ol;hydroxide;hydrate is CC(C)O.O.[NH4+].[OH-].
What is the InChIKey of azanium;propan-2-ol;hydroxide;hydrate?
The InChIKey is XCFYSTUTBNWXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.H3N.2H2O/c1-3(2)4;;;/h3-4H,1-2H3;1H3;2*1H2.
What are the key properties of azanium;propan-2-ol;hydroxide;hydrate?
azanium;propan-2-ol;hydroxide;hydrate has a molecular weight of 113.16 g/mol, XLogP of -0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;propan-2-ol;hydroxide;hydrate is sourced from PubChem (CID 19893943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).