C10H16N2O3S3 — CID 19894286
4-(3-hydroxypropylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 19894286) has the molecular formula C10H16N2O3S3 and a molecular weight of 308.45 g/mol. Its IUPAC name is 4-(3-hydroxypropylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 4-(3-hydroxypropylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 19894286 |
| Molecular Formula | C10H16N2O3S3 |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 4-(3-hydroxypropylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(s1)SCCC2NCCCO |
| InChI | InChI=1S/C10H16N2O3S3/c11-18(14,15)9-6-7-8(12-3-1-4-13)2-5-16-10(7)17-9/h6,8,12-13H,1-5H2,(H2,11,14,15) |
| InChIKey | VHYBDRIKXXUXLM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|