About naphthalen-1-yl 2-methoxyacetate
naphthalen-1-yl 2-methoxyacetate (PubChem CID 19894343) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is naphthalen-1-yl 2-methoxyacetate.
Molecular Properties
| Compound Name | naphthalen-1-yl 2-methoxyacetate |
| PubChem CID | 19894343 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | naphthalen-1-yl 2-methoxyacetate |
| SMILES | COCC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C13H12O3/c1-15-9-13(14)16-12-8-4-6-10-5-2-3-7-11(10)12/h2-8H,9H2,1H3 |
| InChIKey | OQBZOQLZDBXEBJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-yl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-yl 2-methoxyacetate?
The IUPAC name of naphthalen-1-yl 2-methoxyacetate (CID 19894343) is naphthalen-1-yl 2-methoxyacetate.
What is the SMILES notation for naphthalen-1-yl 2-methoxyacetate?
The canonical SMILES for naphthalen-1-yl 2-methoxyacetate is COCC(=O)Oc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-yl 2-methoxyacetate?
The InChIKey is OQBZOQLZDBXEBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-15-9-13(14)16-12-8-4-6-10-5-2-3-7-11(10)12/h2-8H,9H2,1H3.
What are the key properties of naphthalen-1-yl 2-methoxyacetate?
naphthalen-1-yl 2-methoxyacetate has a molecular weight of 216.24 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-yl 2-methoxyacetate is sourced from PubChem (CID 19894343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).