About 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol
4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol (PubChem CID 19894434) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol |
| PubChem CID | 19894434 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol |
| SMILES | C=C=C(CN)Cc1ccc(O)cc1O |
| InChI | InChI=1S/C11H13NO2/c1-2-8(7-12)5-9-3-4-10(13)6-11(9)14/h3-4,6,13-14H,1,5,7,12H2 |
| InChIKey | VNNLPIJQDDKPGX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol?
The IUPAC name of 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol (CID 19894434) is 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol.
What is the SMILES notation for 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol?
The canonical SMILES for 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol is C=C=C(CN)Cc1ccc(O)cc1O.
What is the InChIKey of 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol?
The InChIKey is VNNLPIJQDDKPGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-8(7-12)5-9-3-4-10(13)6-11(9)14/h3-4,6,13-14H,1,5,7,12H2.
What are the key properties of 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol?
4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol has a molecular weight of 191.23 g/mol, XLogP of 1.31, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(aminomethyl)buta-2,3-dienyl]benzene-1,3-diol is sourced from PubChem (CID 19894434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).