C11H15N3O4 — CID 19894488
2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxy]ethanol (PubChem CID 19894488) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxy]ethanol.
| Compound Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxy]ethanol |
|---|---|
| PubChem CID | 19894488 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxy]ethanol |
| SMILES | C=CCOc1nc(OCC=C)nc(OCCO)n1 |
| InChI | InChI=1S/C11H15N3O4/c1-3-6-16-9-12-10(17-7-4-2)14-11(13-9)18-8-5-15/h3-4,15H,1-2,5-8H2 |
| InChIKey | CEDLZKJGQITAFT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|