C47H34N2O6 — CID 19894489
2-[4-[[4-[1,3-dioxo-5-(2-prop-2-enylphenoxy)isoindol-2-yl]phenyl]methyl]phenyl]-5-(2-prop-2-enylphenoxy)isoindole-1,3-dione (PubChem CID 19894489) has the molecular formula C47H34N2O6 and a molecular weight of 722.80 g/mol. Its IUPAC name is 2-[4-[[4-[1,3-dioxo-5-(2-prop-2-enylphenoxy)isoindol-2-yl]phenyl]methyl]phenyl]-5-(2-prop-2-enylphenoxy)isoindole-1,3-dione.
| Compound Name | 2-[4-[[4-[1,3-dioxo-5-(2-prop-2-enylphenoxy)isoindol-2-yl]phenyl]methyl]phenyl]-5-(2-prop-2-enylphenoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 19894489 |
| Molecular Formula | C47H34N2O6 |
| Molecular Weight | 722.80 g/mol |
| Exact Mass | 722.24 |
| IUPAC Name | 2-[4-[[4-[1,3-dioxo-5-(2-prop-2-enylphenoxy)isoindol-2-yl]phenyl]methyl]phenyl]-5-(2-prop-2-enylphenoxy)isoindole-1,3-dione |
| SMILES | C=CCc1ccccc1Oc1ccc2c(c1)C(=O)N(c1ccc(Cc3ccc(N4C(=O)c5ccc(Oc6ccccc6CC=C)cc5C4=O)cc3)cc1)C2=O |
| InChI | InChI=1S/C47H34N2O6/c1-3-9-32-11-5-7-13-42(32)54-36-23-25-38-40(28-36)46(52)48(44(38)50)34-19-15-30(16-20-34)27-31-17-21-35(22-18-31)49-45(51)39-26-24-37(29-41(39)47(49)53)55-43-14-8-6-12-33(43)10-4-2/h3-8,11-26,28-29H,1-2,9-10,27H2 |
| InChIKey | BPSRNGGGWURUQI-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.80 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|