C11H14N2S2 — CID 19894701
2-pyridin-3-ylthiane-2-carbothioamide (PubChem CID 19894701) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-pyridin-3-ylthiane-2-carbothioamide.
| Compound Name | 2-pyridin-3-ylthiane-2-carbothioamide |
|---|---|
| PubChem CID | 19894701 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-pyridin-3-ylthiane-2-carbothioamide |
| SMILES | NC(=S)C1(c2cccnc2)CCCCS1 |
| InChI | InChI=1S/C11H14N2S2/c12-10(14)11(5-1-2-7-15-11)9-4-3-6-13-8-9/h3-4,6,8H,1-2,5,7H2,(H2,12,14) |
| InChIKey | DHMXMESKZWDTGE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|