C11H15N3O5 — CID 19894999
3-(7-amino-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol (PubChem CID 19894999) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 3-(7-amino-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol.
| Compound Name | 3-(7-amino-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 19894999 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 3-(7-amino-6-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)propane-1,2-diol |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])N(CC(O)CO)CCO2 |
| InChI | InChI=1S/C11H15N3O5/c12-8-3-11-10(4-9(8)14(17)18)13(1-2-19-11)5-7(16)6-15/h3-4,7,15-16H,1-2,5-6,12H2 |
| InChIKey | HQIQVPBXZHHANW-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|