About 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine
7-methoxy-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 19895002) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 19895002 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | COc1ccc2c(c1)OCCN2 |
| InChI | InChI=1S/C9H11NO2/c1-11-7-2-3-8-9(6-7)12-5-4-10-8/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | SHPHWZPKRWHBKE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine (CID 19895002) is 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine is COc1ccc2c(c1)OCCN2.
What is the InChIKey of 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is SHPHWZPKRWHBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-11-7-2-3-8-9(6-7)12-5-4-10-8/h2-3,6,10H,4-5H2,1H3.
What are the key properties of 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine?
7-methoxy-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 165.19 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 19895002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).