About 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline
5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline (PubChem CID 19896035) has the molecular formula C12H16FNO3
and a molecular weight of 241.26 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline.
Molecular Properties
| Compound Name | 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline |
| PubChem CID | 19896035 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline |
| SMILES | CC1(C)OCC(COc2ccc(F)c(N)c2)O1 |
| InChI | InChI=1S/C12H16FNO3/c1-12(2)16-7-9(17-12)6-15-8-3-4-10(13)11(14)5-8/h3-5,9H,6-7,14H2,1-2H3 |
| InChIKey | NRBSBMRKTLXVST-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline?
The IUPAC name of 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline (CID 19896035) is 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline.
What is the SMILES notation for 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline?
The canonical SMILES for 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline is CC1(C)OCC(COc2ccc(F)c(N)c2)O1.
What is the InChIKey of 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline?
The InChIKey is NRBSBMRKTLXVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO3/c1-12(2)16-7-9(17-12)6-15-8-3-4-10(13)11(14)5-8/h3-5,9H,6-7,14H2,1-2H3.
What are the key properties of 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline?
5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline has a molecular weight of 241.26 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2-fluoroaniline is sourced from PubChem (CID 19896035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).