About 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione
5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione (PubChem CID 19896214) has the molecular formula C17H10F4N2O3
and a molecular weight of 366.27 g/mol. Its IUPAC name is 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 19896214 |
| Molecular Formula | C17H10F4N2O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(-c2ccccc2)c(F)c(=O)n1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F4N2O3/c18-13-14(10-4-2-1-3-5-10)22-16(25)23(15(13)24)11-6-8-12(9-7-11)26-17(19,20)21/h1-9H,(H,22,25) |
| InChIKey | BDXPOWIXLCIATQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione (CID 19896214) is 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione is O=c1[nH]c(-c2ccccc2)c(F)c(=O)n1-c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione?
The InChIKey is BDXPOWIXLCIATQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F4N2O3/c18-13-14(10-4-2-1-3-5-10)22-16(25)23(15(13)24)11-6-8-12(9-7-11)26-17(19,20)21/h1-9H,(H,22,25).
What are the key properties of 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione?
5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione has a molecular weight of 366.27 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-phenyl-3-[4-(trifluoromethoxy)phenyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 19896214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).