About 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one
4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one (PubChem CID 19897014) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one |
| PubChem CID | 19897014 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one |
| SMILES | CCCCc1ccc(-c2c(C)[nH]c(=O)n2C)cc1 |
| InChI | InChI=1S/C15H20N2O/c1-4-5-6-12-7-9-13(10-8-12)14-11(2)16-15(18)17(14)3/h7-10H,4-6H2,1-3H3,(H,16,18) |
| InChIKey | YRAYEMXOBPSIJZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one?
The IUPAC name of 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one (CID 19897014) is 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one.
What is the SMILES notation for 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one?
The canonical SMILES for 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one is CCCCc1ccc(-c2c(C)[nH]c(=O)n2C)cc1.
What is the InChIKey of 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one?
The InChIKey is YRAYEMXOBPSIJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-4-5-6-12-7-9-13(10-8-12)14-11(2)16-15(18)17(14)3/h7-10H,4-6H2,1-3H3,(H,16,18).
What are the key properties of 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one?
4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one has a molecular weight of 244.34 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-butylphenyl)-3,5-dimethyl-1H-imidazol-2-one is sourced from PubChem (CID 19897014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).