About acetonitrile;benzene-1,2-diol
acetonitrile;benzene-1,2-diol (PubChem CID 19897214) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is acetonitrile;benzene-1,2-diol.
Molecular Properties
| Compound Name | acetonitrile;benzene-1,2-diol |
| PubChem CID | 19897214 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | acetonitrile;benzene-1,2-diol |
| SMILES | CC#N.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H3N/c7-5-3-1-2-4-6(5)8;1-2-3/h1-4,7-8H;1H3 |
| InChIKey | LBRSLYLLACJOOD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;benzene-1,2-diol?
The IUPAC name of acetonitrile;benzene-1,2-diol (CID 19897214) is acetonitrile;benzene-1,2-diol.
What is the SMILES notation for acetonitrile;benzene-1,2-diol?
The canonical SMILES for acetonitrile;benzene-1,2-diol is CC#N.Oc1ccccc1O.
What is the InChIKey of acetonitrile;benzene-1,2-diol?
The InChIKey is LBRSLYLLACJOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H3N/c7-5-3-1-2-4-6(5)8;1-2-3/h1-4,7-8H;1H3.
What are the key properties of acetonitrile;benzene-1,2-diol?
acetonitrile;benzene-1,2-diol has a molecular weight of 151.16 g/mol, XLogP of 1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;benzene-1,2-diol is sourced from PubChem (CID 19897214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).