About methyl 6-methyl-7-oxoheptanoate
methyl 6-methyl-7-oxoheptanoate (PubChem CID 19897350) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is methyl 6-methyl-7-oxoheptanoate.
Molecular Properties
| Compound Name | methyl 6-methyl-7-oxoheptanoate |
| PubChem CID | 19897350 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | methyl 6-methyl-7-oxoheptanoate |
| SMILES | COC(=O)CCCCC(C)C=O |
| InChI | InChI=1S/C9H16O3/c1-8(7-10)5-3-4-6-9(11)12-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | JCZUPLCTYRPQTH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-methyl-7-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-7-oxoheptanoate?
The IUPAC name of methyl 6-methyl-7-oxoheptanoate (CID 19897350) is methyl 6-methyl-7-oxoheptanoate.
What is the SMILES notation for methyl 6-methyl-7-oxoheptanoate?
The canonical SMILES for methyl 6-methyl-7-oxoheptanoate is COC(=O)CCCCC(C)C=O.
What is the InChIKey of methyl 6-methyl-7-oxoheptanoate?
The InChIKey is JCZUPLCTYRPQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-8(7-10)5-3-4-6-9(11)12-2/h7-8H,3-6H2,1-2H3.
What are the key properties of methyl 6-methyl-7-oxoheptanoate?
methyl 6-methyl-7-oxoheptanoate has a molecular weight of 172.22 g/mol, XLogP of 1.55, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-7-oxoheptanoate is sourced from PubChem (CID 19897350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).