About 2-(3-ethynylphenyl)-1,3-dioxolane
2-(3-ethynylphenyl)-1,3-dioxolane (PubChem CID 19897393) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(3-ethynylphenyl)-1,3-dioxolane |
| PubChem CID | 19897393 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-(3-ethynylphenyl)-1,3-dioxolane |
| SMILES | C#Cc1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C11H10O2/c1-2-9-4-3-5-10(8-9)11-12-6-7-13-11/h1,3-5,8,11H,6-7H2 |
| InChIKey | PJQOKBVNXBFHQW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethynylphenyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethynylphenyl)-1,3-dioxolane?
The IUPAC name of 2-(3-ethynylphenyl)-1,3-dioxolane (CID 19897393) is 2-(3-ethynylphenyl)-1,3-dioxolane.
What is the SMILES notation for 2-(3-ethynylphenyl)-1,3-dioxolane?
The canonical SMILES for 2-(3-ethynylphenyl)-1,3-dioxolane is C#Cc1cccc(C2OCCO2)c1.
What is the InChIKey of 2-(3-ethynylphenyl)-1,3-dioxolane?
The InChIKey is PJQOKBVNXBFHQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c1-2-9-4-3-5-10(8-9)11-12-6-7-13-11/h1,3-5,8,11H,6-7H2.
What are the key properties of 2-(3-ethynylphenyl)-1,3-dioxolane?
2-(3-ethynylphenyl)-1,3-dioxolane has a molecular weight of 174.20 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethynylphenyl)-1,3-dioxolane is sourced from PubChem (CID 19897393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).