C23H31N3O2 — CID 19897675
6,7-dimethyl-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 19897675) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 6,7-dimethyl-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6,7-dimethyl-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 19897675 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 6,7-dimethyl-2-[3-[methyl-[3-(1-oxidopyridin-1-ium-3-yl)propyl]amino]propyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | Cc1cc2c(cc1C)C(=O)N(CCCN(C)CCCc1ccc[n+]([O-])c1)CC2 |
| InChI | InChI=1S/C23H31N3O2/c1-18-15-21-9-14-25(23(27)22(21)16-19(18)2)12-6-11-24(3)10-4-7-20-8-5-13-26(28)17-20/h5,8,13,15-17H,4,6-7,9-12,14H2,1-3H3 |
| InChIKey | ADUXXVDCXHKZDG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|