C13H15NO5 — CID 19897748
3-(6,7-dimethoxy-1,3-dioxo-7aH-isoindol-3a-yl)propanal (PubChem CID 19897748) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-1,3-dioxo-7aH-isoindol-3a-yl)propanal.
| Compound Name | 3-(6,7-dimethoxy-1,3-dioxo-7aH-isoindol-3a-yl)propanal |
|---|---|
| PubChem CID | 19897748 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-(6,7-dimethoxy-1,3-dioxo-7aH-isoindol-3a-yl)propanal |
| SMILES | COC1=C(OC)C2C(=O)NC(=O)C2(CCC=O)C=C1 |
| InChI | InChI=1S/C13H15NO5/c1-18-8-4-6-13(5-3-7-15)9(10(8)19-2)11(16)14-12(13)17/h4,6-7,9H,3,5H2,1-2H3,(H,14,16,17) |
| InChIKey | PMOXUUQASNPMAV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|