About [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+)
[1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) (PubChem CID 19897942) has the molecular formula C8H18N2Pt+2
and a molecular weight of 337.32 g/mol. Its IUPAC name is [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+).
Molecular Properties
| Compound Name | [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) |
| PubChem CID | 19897942 |
| Molecular Formula | C8H18N2Pt+2 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) |
| SMILES | NCC1(CN)CCCCC1.[Pt+2] |
| InChI | InChI=1S/C8H18N2.Pt/c9-6-8(7-10)4-2-1-3-5-8;/h1-7,9-10H2;/q;+2 |
| InChIKey | RTBYOAQLDYVZQT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+)?
The IUPAC name of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) (CID 19897942) is [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+).
What is the SMILES notation for [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+)?
The canonical SMILES for [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) is NCC1(CN)CCCCC1.[Pt+2].
What is the InChIKey of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+)?
The InChIKey is RTBYOAQLDYVZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.Pt/c9-6-8(7-10)4-2-1-3-5-8;/h1-7,9-10H2;/q;+2.
What are the key properties of [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+)?
[1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) has a molecular weight of 337.32 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)cyclohexyl]methanamine;platinum(2+) is sourced from PubChem (CID 19897942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).