C23H41ClN2O3Si — CID 19897983
N,N-dicyclohexyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride (PubChem CID 19897983) has the molecular formula C23H41ClN2O3Si and a molecular weight of 457.13 g/mol. Its IUPAC name is N,N-dicyclohexyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride.
| Compound Name | N,N-dicyclohexyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 19897983 |
| Molecular Formula | C23H41ClN2O3Si |
| Molecular Weight | 457.13 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N,N-dicyclohexyl-1-(3-trimethoxysilylpropyl)pyridin-1-ium-4-amine chloride |
| SMILES | CO[Si](CCC[n+]1ccc(N(C2CCCCC2)C2CCCCC2)cc1)(OC)OC.[Cl-] |
| InChI | InChI=1S/C23H41N2O3Si.ClH/c1-26-29(27-2,28-3)20-10-17-24-18-15-23(16-19-24)25(21-11-6-4-7-12-21)22-13-8-5-9-14-22;/h15-16,18-19,21-22H,4-14,17,20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HHZJERUUBNGOLU-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 34.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|