C7H9Cl2F3O — CID 19898051
[2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropyl]methanol (PubChem CID 19898051) has the molecular formula C7H9Cl2F3O and a molecular weight of 237.05 g/mol. Its IUPAC name is [2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropyl]methanol.
| Compound Name | [2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 19898051 |
| Molecular Formula | C7H9Cl2F3O |
| Molecular Weight | 237.05 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | [2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropyl]methanol |
| SMILES | CC1(CC(F)(F)F)C(CO)C1(Cl)Cl |
| InChI | InChI=1S/C7H9Cl2F3O/c1-5(3-6(10,11)12)4(2-13)7(5,8)9/h4,13H,2-3H2,1H3 |
| InChIKey | OVMVJDUTEDXNNR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.05 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|