C14H12Cl2N2O5 — CID 19898159
3-(4,5-dichloro-2-nitrobenzoyl)-6,6-dimethylpiperidine-2,4-dione (PubChem CID 19898159) has the molecular formula C14H12Cl2N2O5 and a molecular weight of 359.17 g/mol. Its IUPAC name is 3-(4,5-dichloro-2-nitrobenzoyl)-6,6-dimethylpiperidine-2,4-dione.
| Compound Name | 3-(4,5-dichloro-2-nitrobenzoyl)-6,6-dimethylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 19898159 |
| Molecular Formula | C14H12Cl2N2O5 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 3-(4,5-dichloro-2-nitrobenzoyl)-6,6-dimethylpiperidine-2,4-dione |
| SMILES | CC1(C)CC(=O)C(C(=O)c2cc(Cl)c(Cl)cc2[N+](=O)[O-])C(=O)N1 |
| InChI | InChI=1S/C14H12Cl2N2O5/c1-14(2)5-10(19)11(13(21)17-14)12(20)6-3-7(15)8(16)4-9(6)18(22)23/h3-4,11H,5H2,1-2H3,(H,17,21) |
| InChIKey | WCGUZOZOIKRLSB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|